C15H23N5O7S — CID 20579610
2-(benzenesulfonamido)-3-[2-[2-(diaminomethylideneamino)ethoxy]ethoxycarbonylamino]propanoic acid (PubChem CID 20579610) has the molecular formula C15H23N5O7S and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3-[2-[2-(diaminomethylideneamino)ethoxy]ethoxycarbonylamino]propanoic acid.
| Compound Name | 2-(benzenesulfonamido)-3-[2-[2-(diaminomethylideneamino)ethoxy]ethoxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 20579610 |
| Molecular Formula | C15H23N5O7S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-(benzenesulfonamido)-3-[2-[2-(diaminomethylideneamino)ethoxy]ethoxycarbonylamino]propanoic acid |
| SMILES | NC(N)=NCCOCCOC(=O)NCC(NS(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H23N5O7S/c16-14(17)18-6-7-26-8-9-27-15(23)19-10-12(13(21)22)20-28(24,25)11-4-2-1-3-5-11/h1-5,12,20H,6-10H2,(H,19,23)(H,21,22)(H4,16,17,18) |
| InChIKey | YXVGCJIHWWYWDA-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 195.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|