C10H22N5O7PS — CID 20579642
3-[[2-[2-[2-(diaminomethylideneamino)ethoxy]ethoxy]acetyl]amino]-2-(phosphanylsulfonylamino)propanoic acid (PubChem CID 20579642) has the molecular formula C10H22N5O7PS and a molecular weight of 387.36 g/mol. Its IUPAC name is 3-[[2-[2-[2-(diaminomethylideneamino)ethoxy]ethoxy]acetyl]amino]-2-(phosphanylsulfonylamino)propanoic acid.
| Compound Name | 3-[[2-[2-[2-(diaminomethylideneamino)ethoxy]ethoxy]acetyl]amino]-2-(phosphanylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 20579642 |
| Molecular Formula | C10H22N5O7PS |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-[[2-[2-[2-(diaminomethylideneamino)ethoxy]ethoxy]acetyl]amino]-2-(phosphanylsulfonylamino)propanoic acid |
| SMILES | NC(N)=NCCOCCOCC(=O)NCC(NS(=O)(=O)P)C(=O)O |
| InChI | InChI=1S/C10H22N5O7PS/c11-10(12)13-1-2-21-3-4-22-6-8(16)14-5-7(9(17)18)15-24(19,20)23/h7,15H,1-6,23H2,(H,14,16)(H,17,18)(H4,11,12,13) |
| InChIKey | FRSDWLIDPDUWMO-UHFFFAOYSA-N |
| XLogP | -3.43 |
| TPSA | 195.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|