C19H34N6O10 — CID 53474453
(2S)-2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]pentanoyl]amino]acetyl]amino]butanedioic acid (PubChem CID 53474453) has the molecular formula C19H34N6O10 and a molecular weight of 506.51 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]pentanoyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]pentanoyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 53474453 |
| Molecular Formula | C19H34N6O10 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]pentanoyl]amino]acetyl]amino]butanedioic acid |
| SMILES | COCCOCCOCC(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H34N6O10/c1-33-5-6-34-7-8-35-11-15(27)24-12(3-2-4-22-19(20)21)17(30)23-10-14(26)25-13(18(31)32)9-16(28)29/h12-13H,2-11H2,1H3,(H,23,30)(H,24,27)(H,25,26)(H,28,29)(H,31,32)(H4,20,21,22)/t12-,13-/m0/s1 |
| InChIKey | SWSPVOCRBCSBEW-STQMWFEESA-N |
| XLogP | -3.64 |
| TPSA | 253.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|