C18H31N5O4S — CID 10136480
(2R)-2-(benzenesulfonamido)-3-[8-(diaminomethylideneamino)octylamino]propanoic acid (PubChem CID 10136480) has the molecular formula C18H31N5O4S and a molecular weight of 413.54 g/mol. Its IUPAC name is (2R)-2-(benzenesulfonamido)-3-[8-(diaminomethylideneamino)octylamino]propanoic acid.
| Compound Name | (2R)-2-(benzenesulfonamido)-3-[8-(diaminomethylideneamino)octylamino]propanoic acid |
|---|---|
| PubChem CID | 10136480 |
| Molecular Formula | C18H31N5O4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (2R)-2-(benzenesulfonamido)-3-[8-(diaminomethylideneamino)octylamino]propanoic acid |
| SMILES | NC(N)=NCCCCCCCCNC[C@@H](NS(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H31N5O4S/c19-18(20)22-13-9-4-2-1-3-8-12-21-14-16(17(24)25)23-28(26,27)15-10-6-5-7-11-15/h5-7,10-11,16,21,23H,1-4,8-9,12-14H2,(H,24,25)(H4,19,20,22)/t16-/m1/s1 |
| InChIKey | QUILWMAPVQEQRG-MRXNPFEDSA-N |
| XLogP | 0.62 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|