C8H17N3O2S — CID 18656744
(2S)-2-amino-5-[[amino(methylsulfanyl)methylidene]amino]-3-methylpentanoic acid (PubChem CID 18656744) has the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. Its IUPAC name is (2S)-2-amino-5-[[amino(methylsulfanyl)methylidene]amino]-3-methylpentanoic acid.
| Compound Name | (2S)-2-amino-5-[[amino(methylsulfanyl)methylidene]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18656744 |
| Molecular Formula | C8H17N3O2S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | (2S)-2-amino-5-[[amino(methylsulfanyl)methylidene]amino]-3-methylpentanoic acid |
| SMILES | CS/C(N)=N\CCC(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H17N3O2S/c1-5(6(9)7(12)13)3-4-11-8(10)14-2/h5-6H,3-4,9H2,1-2H3,(H2,10,11)(H,12,13)/t5?,6-/m0/s1 |
| InChIKey | IYQPIKQSPAZZBN-GDVGLLTNSA-N |
| XLogP | 0.10 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|