C8H18N4O — CID 134551000
2-[(3R,4R)-4-amino-3-methyl-5-oxohexyl]guanidine (PubChem CID 134551000) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-[(3R,4R)-4-amino-3-methyl-5-oxohexyl]guanidine.
| Compound Name | 2-[(3R,4R)-4-amino-3-methyl-5-oxohexyl]guanidine |
|---|---|
| PubChem CID | 134551000 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 2-[(3R,4R)-4-amino-3-methyl-5-oxohexyl]guanidine |
| SMILES | CC(=O)[C@H](N)[C@H](C)CCN=C(N)N |
| InChI | InChI=1S/C8H18N4O/c1-5(7(9)6(2)13)3-4-12-8(10)11/h5,7H,3-4,9H2,1-2H3,(H4,10,11,12)/t5-,7-/m1/s1 |
| InChIKey | HXWHJYUXRHBFOR-IYSWYEEDSA-N |
| XLogP | -0.80 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|