C7H17N5O — CID 91251591
2-(3,5-diamino-4-oxohexyl)guanidine (PubChem CID 91251591) has the molecular formula C7H17N5O and a molecular weight of 187.25 g/mol. Its IUPAC name is 2-(3,5-diamino-4-oxohexyl)guanidine.
| Compound Name | 2-(3,5-diamino-4-oxohexyl)guanidine |
|---|---|
| PubChem CID | 91251591 |
| Molecular Formula | C7H17N5O |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-(3,5-diamino-4-oxohexyl)guanidine |
| SMILES | CC(N)C(=O)C(N)CCN=C(N)N |
| InChI | InChI=1S/C7H17N5O/c1-4(8)6(13)5(9)2-3-12-7(10)11/h4-5H,2-3,8-9H2,1H3,(H4,10,11,12) |
| InChIKey | PDRQXXBWJXGNFU-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|