C10H19N3O2 — CID 57205815
(2S)-2-amino-5-(1-aminobut-3-enylideneamino)-3-methylpentanoic acid (PubChem CID 57205815) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is (2S)-2-amino-5-(1-aminobut-3-enylideneamino)-3-methylpentanoic acid.
| Compound Name | (2S)-2-amino-5-(1-aminobut-3-enylideneamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 57205815 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (2S)-2-amino-5-(1-aminobut-3-enylideneamino)-3-methylpentanoic acid |
| SMILES | C=CC/C(N)=N\CCC(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H19N3O2/c1-3-4-8(11)13-6-5-7(2)9(12)10(14)15/h3,7,9H,1,4-6,12H2,2H3,(H2,11,13)(H,14,15)/t7?,9-/m0/s1 |
| InChIKey | UYIKRXFVYFTVRT-NETXQHHPSA-N |
| XLogP | 0.36 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|