C9H17N3O2 — CID 22141943
2-amino-5-(1-aminobut-3-enylideneamino)pentanoic acid (PubChem CID 22141943) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-amino-5-(1-aminobut-3-enylideneamino)pentanoic acid.
| Compound Name | 2-amino-5-(1-aminobut-3-enylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 22141943 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-amino-5-(1-aminobut-3-enylideneamino)pentanoic acid |
| SMILES | C=CC/C(N)=N\CCCC(N)C(=O)O |
| InChI | InChI=1S/C9H17N3O2/c1-2-4-8(11)12-6-3-5-7(10)9(13)14/h2,7H,1,3-6,10H2,(H2,11,12)(H,13,14) |
| InChIKey | LMDRHVQXMBGSGU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|