C8H18ClN3O2 — CID 90470185
(2S)-2-amino-5-(1-aminopropylideneamino)pentanoic acid;hydrochloride (PubChem CID 90470185) has the molecular formula C8H18ClN3O2 and a molecular weight of 223.70 g/mol. Its IUPAC name is (2S)-2-amino-5-(1-aminopropylideneamino)pentanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-5-(1-aminopropylideneamino)pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 90470185 |
| Molecular Formula | C8H18ClN3O2 |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2S)-2-amino-5-(1-aminopropylideneamino)pentanoic acid;hydrochloride |
| SMILES | CC/C(N)=N\CCC[C@H](N)C(=O)O.Cl |
| InChI | InChI=1S/C8H17N3O2.ClH/c1-2-7(10)11-5-3-4-6(9)8(12)13;/h6H,2-5,9H2,1H3,(H2,10,11)(H,12,13);1H/t6-;/m0./s1 |
| InChIKey | FADRJPGCWHNIBW-RGMNGODLSA-N |
| XLogP | 0.37 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|