C10H23Cl2N3O2S — CID 45379044
(2S)-2-amino-5-[(1-amino-2-propylsulfanylethylidene)amino]pentanoic acid;dihydrochloride (PubChem CID 45379044) has the molecular formula C10H23Cl2N3O2S and a molecular weight of 320.29 g/mol. Its IUPAC name is (2S)-2-amino-5-[(1-amino-2-propylsulfanylethylidene)amino]pentanoic acid;dihydrochloride.
| Compound Name | (2S)-2-amino-5-[(1-amino-2-propylsulfanylethylidene)amino]pentanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 45379044 |
| Molecular Formula | C10H23Cl2N3O2S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (2S)-2-amino-5-[(1-amino-2-propylsulfanylethylidene)amino]pentanoic acid;dihydrochloride |
| SMILES | CCCSC/C(N)=N\CCC[C@H](N)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C10H21N3O2S.2ClH/c1-2-6-16-7-9(12)13-5-3-4-8(11)10(14)15;;/h8H,2-7,11H2,1H3,(H2,12,13)(H,14,15);2*1H/t8-;;/m0../s1 |
| InChIKey | ALJGFXJKQAOTFC-JZGIKJSDSA-N |
| XLogP | 1.52 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|