C21H35NO8 — CID 59050686
1-O-ethyl 7-O-methyl (Z,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylhept-2-enedioate (PubChem CID 59050686) has the molecular formula C21H35NO8 and a molecular weight of 429.51 g/mol. Its IUPAC name is 1-O-ethyl 7-O-methyl (Z,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylhept-2-enedioate.
| Compound Name | 1-O-ethyl 7-O-methyl (Z,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylhept-2-enedioate |
|---|---|
| PubChem CID | 59050686 |
| Molecular Formula | C21H35NO8 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-O-ethyl 7-O-methyl (Z,6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylhept-2-enedioate |
| SMILES | CCOC(=O)/C(C)=C\CC[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35NO8/c1-10-28-16(23)14(2)12-11-13-15(17(24)27-9)22(18(25)29-20(3,4)5)19(26)30-21(6,7)8/h12,15H,10-11,13H2,1-9H3/b14-12-/t15-/m0/s1 |
| InChIKey | HNHNAYDDZMOLRP-ZSMUJPCHSA-N |
| XLogP | 3.99 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|