C22H35N3O8 — CID 59035973
methyl (E)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methyl-7-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)hept-5-enoate (PubChem CID 59035973) has the molecular formula C22H35N3O8 and a molecular weight of 469.54 g/mol. Its IUPAC name is methyl (E)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methyl-7-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)hept-5-enoate.
| Compound Name | methyl (E)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methyl-7-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)hept-5-enoate |
|---|---|
| PubChem CID | 59035973 |
| Molecular Formula | C22H35N3O8 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | methyl (E)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methyl-7-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)hept-5-enoate |
| SMILES | COC(=O)C(CC/C=C(\C)Cn1c(C)noc1=O)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O8/c1-14(13-24-15(2)23-33-18(24)27)11-10-12-16(17(26)30-9)25(19(28)31-21(3,4)5)20(29)32-22(6,7)8/h11,16H,10,12-13H2,1-9H3/b14-11+ |
| InChIKey | RLCSZSWCGIDWQF-SDNWHVSQSA-N |
| XLogP | 3.59 |
| TPSA | 130.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|