C27H47NO8 — CID 123683723
12-O-tert-butyl 1-O-methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]dodec-4-enedioate (PubChem CID 123683723) has the molecular formula C27H47NO8 and a molecular weight of 513.67 g/mol. Its IUPAC name is 12-O-tert-butyl 1-O-methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]dodec-4-enedioate.
| Compound Name | 12-O-tert-butyl 1-O-methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]dodec-4-enedioate |
|---|---|
| PubChem CID | 123683723 |
| Molecular Formula | C27H47NO8 |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.33 |
| IUPAC Name | 12-O-tert-butyl 1-O-methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]dodec-4-enedioate |
| SMILES | COC(=O)[C@H](CC=CCCCCCCC(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H47NO8/c1-25(2,3)34-21(29)19-17-15-13-11-12-14-16-18-20(22(30)33-10)28(23(31)35-26(4,5)6)24(32)36-27(7,8)9/h14,16,20H,11-13,15,17-19H2,1-10H3/t20-/m0/s1 |
| InChIKey | JDKQALWOVLXYED-FQEVSTJZSA-N |
| XLogP | 6.33 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|