C11H18N4O7 — CID 88729718
5-amino-2-[(2-aminoacetyl)-(2-amino-3-carboxypropanoyl)amino]-5-oxopentanoic acid (PubChem CID 88729718) has the molecular formula C11H18N4O7 and a molecular weight of 318.29 g/mol. Its IUPAC name is 5-amino-2-[(2-aminoacetyl)-(2-amino-3-carboxypropanoyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(2-aminoacetyl)-(2-amino-3-carboxypropanoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 88729718 |
| Molecular Formula | C11H18N4O7 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 5-amino-2-[(2-aminoacetyl)-(2-amino-3-carboxypropanoyl)amino]-5-oxopentanoic acid |
| SMILES | NCC(=O)N(C(=O)C(N)CC(=O)O)C(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H18N4O7/c12-4-8(17)15(10(20)5(13)3-9(18)19)6(11(21)22)1-2-7(14)16/h5-6H,1-4,12-13H2,(H2,14,16)(H,18,19)(H,21,22) |
| InChIKey | ZIWRLCMPKFTAIG-UHFFFAOYSA-N |
| XLogP | -3.18 |
| TPSA | 207.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |