C6H12O3 — CID 20508399
3-ethoxybutanoic acid (PubChem CID 20508399) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is 3-ethoxybutanoic acid.
| Compound Name | 3-ethoxybutanoic acid |
|---|---|
| PubChem CID | 20508399 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 3-ethoxybutanoic acid |
| SMILES | CCOC(C)CC(=O)O |
| InChI | InChI=1S/C6H12O3/c1-3-9-5(2)4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | OPXOAENGHZNGBT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |