About barium(2+);2-(carboxylatomethoxy)butanoate
barium(2+);2-(carboxylatomethoxy)butanoate (PubChem CID 87916357) has the molecular formula C6H8BaO5
and a molecular weight of 297.45 g/mol. Its IUPAC name is barium(2+);2-(carboxylatomethoxy)butanoate.
Molecular Properties
| Compound Name | barium(2+);2-(carboxylatomethoxy)butanoate |
| PubChem CID | 87916357 |
| Molecular Formula | C6H8BaO5 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.94 |
| IUPAC Name | barium(2+);2-(carboxylatomethoxy)butanoate |
| SMILES | CCC(OCC(=O)[O-])C(=O)[O-].[Ba+2] |
| InChI | InChI=1S/C6H10O5.Ba/c1-2-4(6(9)10)11-3-5(7)8;/h4H,2-3H2,1H3,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChIKey | DCAZNIVXUGUTBJ-UHFFFAOYSA-L |
| XLogP | -3.10 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze barium(2+);2-(carboxylatomethoxy)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);2-(carboxylatomethoxy)butanoate?
The IUPAC name of barium(2+);2-(carboxylatomethoxy)butanoate (CID 87916357) is barium(2+);2-(carboxylatomethoxy)butanoate.
What is the SMILES notation for barium(2+);2-(carboxylatomethoxy)butanoate?
The canonical SMILES for barium(2+);2-(carboxylatomethoxy)butanoate is CCC(OCC(=O)[O-])C(=O)[O-].[Ba+2].
What is the InChIKey of barium(2+);2-(carboxylatomethoxy)butanoate?
The InChIKey is DCAZNIVXUGUTBJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H10O5.Ba/c1-2-4(6(9)10)11-3-5(7)8;/h4H,2-3H2,1H3,(H,7,8)(H,9,10);/q;+2/p-2.
What are the key properties of barium(2+);2-(carboxylatomethoxy)butanoate?
barium(2+);2-(carboxylatomethoxy)butanoate has a molecular weight of 297.45 g/mol, XLogP of -3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);2-(carboxylatomethoxy)butanoate is sourced from PubChem (CID 87916357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).