C6H5K2NaO7 — CID 172785567
dipotassium;sodium;2-(carboxylatomethoxy)butanedioate (PubChem CID 172785567) has the molecular formula C6H5K2NaO7 and a molecular weight of 290.29 g/mol. Its IUPAC name is dipotassium;sodium;2-(carboxylatomethoxy)butanedioate.
| Compound Name | dipotassium;sodium;2-(carboxylatomethoxy)butanedioate |
|---|---|
| PubChem CID | 172785567 |
| Molecular Formula | C6H5K2NaO7 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 289.92 |
| IUPAC Name | dipotassium;sodium;2-(carboxylatomethoxy)butanedioate |
| SMILES | O=C([O-])COC(CC(=O)[O-])C(=O)[O-].[K+].[K+].[Na+] |
| InChI | InChI=1S/C6H8O7.2K.Na/c7-4(8)1-3(6(11)12)13-2-5(9)10;;;/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;3*+1/p-3 |
| InChIKey | OVPKSCUHIDKJBY-UHFFFAOYSA-K |
| XLogP | -13.98 |
| TPSA | 129.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | -13.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |