C5H7K2N3O4 — CID 169227239
dipotassium;2-(diaminomethylideneamino)butanedioate (PubChem CID 169227239) has the molecular formula C5H7K2N3O4 and a molecular weight of 251.32 g/mol. Its IUPAC name is dipotassium;2-(diaminomethylideneamino)butanedioate.
| Compound Name | dipotassium;2-(diaminomethylideneamino)butanedioate |
|---|---|
| PubChem CID | 169227239 |
| Molecular Formula | C5H7K2N3O4 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | dipotassium;2-(diaminomethylideneamino)butanedioate |
| SMILES | NC(N)=NC(CC(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C5H9N3O4.2K/c6-5(7)8-2(4(11)12)1-3(9)10;;/h2H,1H2,(H,9,10)(H,11,12)(H4,6,7,8);;/q;2*+1/p-2 |
| InChIKey | KMBKUWCPAGENKG-UHFFFAOYSA-L |
| XLogP | -10.47 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | -10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|