C9H19NO4 — CID 88690557
1,1-diethoxyethane;(1E)-1-hydroxyiminopropan-2-one (PubChem CID 88690557) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is 1,1-diethoxyethane;(1E)-1-hydroxyiminopropan-2-one.
| Compound Name | 1,1-diethoxyethane;(1E)-1-hydroxyiminopropan-2-one |
|---|---|
| PubChem CID | 88690557 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1,1-diethoxyethane;(1E)-1-hydroxyiminopropan-2-one |
| SMILES | CC(=O)/C=N/O.CCOC(C)OCC |
| InChI | InChI=1S/C6H14O2.C3H5NO2/c1-4-7-6(3)8-5-2;1-3(5)2-4-6/h6H,4-5H2,1-3H3;2,6H,1H3/b;4-2+ |
| InChIKey | JRIUXXXOZKSWDK-QGLCECKVSA-N |
| XLogP | 1.44 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|