C14H28O6 — CID 135314498
1,1-diethoxyethane;2-hydroxyethyl 2-ethyl-3-oxobutanoate (PubChem CID 135314498) has the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. Its IUPAC name is 1,1-diethoxyethane;2-hydroxyethyl 2-ethyl-3-oxobutanoate.
| Compound Name | 1,1-diethoxyethane;2-hydroxyethyl 2-ethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 135314498 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1,1-diethoxyethane;2-hydroxyethyl 2-ethyl-3-oxobutanoate |
| SMILES | CCC(C(C)=O)C(=O)OCCO.CCOC(C)OCC |
| InChI | InChI=1S/C8H14O4.C6H14O2/c1-3-7(6(2)10)8(11)12-5-4-9;1-4-7-6(3)8-5-2/h7,9H,3-5H2,1-2H3;6H,4-5H2,1-3H3 |
| InChIKey | CHCPSZUDJKNANW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|