C10H16O2 — CID 10352079
(2E,5E)-7-ethoxyocta-2,5-dien-4-one (PubChem CID 10352079) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (2E,5E)-7-ethoxyocta-2,5-dien-4-one.
| Compound Name | (2E,5E)-7-ethoxyocta-2,5-dien-4-one |
|---|---|
| PubChem CID | 10352079 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (2E,5E)-7-ethoxyocta-2,5-dien-4-one |
| SMILES | C/C=C/C(=O)/C=C/C(C)OCC |
| InChI | InChI=1S/C10H16O2/c1-4-6-10(11)8-7-9(3)12-5-2/h4,6-9H,5H2,1-3H3/b6-4+,8-7+ |
| InChIKey | PEFMMQKAWJKCQY-GFGVWQOPSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|