C8H11NO2 — CID 123336554
(2Z,5Z)-7-nitrosoocta-2,5-dien-4-one (PubChem CID 123336554) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (2Z,5Z)-7-nitrosoocta-2,5-dien-4-one.
| Compound Name | (2Z,5Z)-7-nitrosoocta-2,5-dien-4-one |
|---|---|
| PubChem CID | 123336554 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (2Z,5Z)-7-nitrosoocta-2,5-dien-4-one |
| SMILES | C/C=C\C(=O)/C=C\C(C)N=O |
| InChI | InChI=1S/C8H11NO2/c1-3-4-8(10)6-5-7(2)9-11/h3-7H,1-2H3/b4-3-,6-5- |
| InChIKey | RXZFNWRSRAEFMX-OUPQRBNQSA-N |
| XLogP | 1.84 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|