C12H22O6S — CID 131866189
5,5-diethoxy-3-ethylsulfonyl-4-methylpent-2-enoic acid (PubChem CID 131866189) has the molecular formula C12H22O6S and a molecular weight of 294.37 g/mol. Its IUPAC name is 5,5-diethoxy-3-ethylsulfonyl-4-methylpent-2-enoic acid.
| Compound Name | 5,5-diethoxy-3-ethylsulfonyl-4-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 131866189 |
| Molecular Formula | C12H22O6S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 5,5-diethoxy-3-ethylsulfonyl-4-methylpent-2-enoic acid |
| SMILES | CCOC(OCC)C(C)C(=CC(=O)O)S(=O)(=O)CC |
| InChI | InChI=1S/C12H22O6S/c1-5-17-12(18-6-2)9(4)10(8-11(13)14)19(15,16)7-3/h8-9,12H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | FYLMDYWENCJMKM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|