C17H31NO6 — CID 171477844
ethyl (Z)-5,5-diethoxy-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate (PubChem CID 171477844) has the molecular formula C17H31NO6 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl (Z)-5,5-diethoxy-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate.
| Compound Name | ethyl (Z)-5,5-diethoxy-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
|---|---|
| PubChem CID | 171477844 |
| Molecular Formula | C17H31NO6 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | ethyl (Z)-5,5-diethoxy-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
| SMILES | CCOC(=O)/C=C(\NC(=O)OC(C)(C)C)C(C)C(OCC)OCC |
| InChI | InChI=1S/C17H31NO6/c1-8-21-14(19)11-13(18-16(20)24-17(5,6)7)12(4)15(22-9-2)23-10-3/h11-12,15H,8-10H2,1-7H3,(H,18,20)/b13-11- |
| InChIKey | FKFYBZTVYSYBCB-QBFSEMIESA-N |
| XLogP | 2.99 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|