C12H22O2 — CID 10352717
(E)-10-hydroxy-2,6-dimethyldec-3-en-5-one (PubChem CID 10352717) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (E)-10-hydroxy-2,6-dimethyldec-3-en-5-one.
| Compound Name | (E)-10-hydroxy-2,6-dimethyldec-3-en-5-one |
|---|---|
| PubChem CID | 10352717 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (E)-10-hydroxy-2,6-dimethyldec-3-en-5-one |
| SMILES | CC(C)/C=C/C(=O)C(C)CCCCO |
| InChI | InChI=1S/C12H22O2/c1-10(2)7-8-12(14)11(3)6-4-5-9-13/h7-8,10-11,13H,4-6,9H2,1-3H3/b8-7+ |
| InChIKey | OJGFNXINDWTNRC-BQYQJAHWSA-N |
| XLogP | 2.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|