About 8-methylnonan-1-ol;prop-2-enoic acid
8-methylnonan-1-ol;prop-2-enoic acid (PubChem CID 175073761) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is 8-methylnonan-1-ol;prop-2-enoic acid.
Molecular Properties
| Compound Name | 8-methylnonan-1-ol;prop-2-enoic acid |
| PubChem CID | 175073761 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 8-methylnonan-1-ol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(C)CCCCCCCO |
| InChI | InChI=1S/C10H22O.C3H4O2/c1-10(2)8-6-4-3-5-7-9-11;1-2-3(4)5/h10-11H,3-9H2,1-2H3;2H,1H2,(H,4,5) |
| InChIKey | JIBDCQYXEBTRFO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 8-methylnonan-1-ol;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylnonan-1-ol;prop-2-enoic acid?
The IUPAC name of 8-methylnonan-1-ol;prop-2-enoic acid (CID 175073761) is 8-methylnonan-1-ol;prop-2-enoic acid.
What is the SMILES notation for 8-methylnonan-1-ol;prop-2-enoic acid?
The canonical SMILES for 8-methylnonan-1-ol;prop-2-enoic acid is C=CC(=O)O.CC(C)CCCCCCCO.
What is the InChIKey of 8-methylnonan-1-ol;prop-2-enoic acid?
The InChIKey is JIBDCQYXEBTRFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O.C3H4O2/c1-10(2)8-6-4-3-5-7-9-11;1-2-3(4)5/h10-11H,3-9H2,1-2H3;2H,1H2,(H,4,5).
What are the key properties of 8-methylnonan-1-ol;prop-2-enoic acid?
8-methylnonan-1-ol;prop-2-enoic acid has a molecular weight of 230.35 g/mol, XLogP of 3.23, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylnonan-1-ol;prop-2-enoic acid is sourced from PubChem (CID 175073761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).