C16H29NO3 — CID 158939992
N-(8-methylnonyl)prop-2-enamide;prop-2-enoic acid (PubChem CID 158939992) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is N-(8-methylnonyl)prop-2-enamide;prop-2-enoic acid.
| Compound Name | N-(8-methylnonyl)prop-2-enamide;prop-2-enoic acid |
|---|---|
| PubChem CID | 158939992 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | N-(8-methylnonyl)prop-2-enamide;prop-2-enoic acid |
| SMILES | C=CC(=O)NCCCCCCCC(C)C.C=CC(=O)O |
| InChI | InChI=1S/C13H25NO.C3H4O2/c1-4-13(15)14-11-9-7-5-6-8-10-12(2)3;1-2-3(4)5/h4,12H,1,5-11H2,2-3H3,(H,14,15);2H,1H2,(H,4,5) |
| InChIKey | JKCYJGLJRFSWLE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|