C16H26O7 — CID 90719390
1-(4,8-dihydroxy-3-oxooct-1-enoxy)-4,8-dihydroxyoct-1-en-3-one (PubChem CID 90719390) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-(4,8-dihydroxy-3-oxooct-1-enoxy)-4,8-dihydroxyoct-1-en-3-one.
| Compound Name | 1-(4,8-dihydroxy-3-oxooct-1-enoxy)-4,8-dihydroxyoct-1-en-3-one |
|---|---|
| PubChem CID | 90719390 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-(4,8-dihydroxy-3-oxooct-1-enoxy)-4,8-dihydroxyoct-1-en-3-one |
| SMILES | O=C(C=COC=CC(=O)C(O)CCCCO)C(O)CCCCO |
| InChI | InChI=1S/C16H26O7/c17-9-3-1-5-13(19)15(21)7-11-23-12-8-16(22)14(20)6-2-4-10-18/h7-8,11-14,17-20H,1-6,9-10H2 |
| InChIKey | YISBVEYAPVEBMR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|