C5H8O4 — CID 135331774
3,5-dihydroxy-2-oxopentanal (PubChem CID 135331774) has the molecular formula C5H8O4 and a molecular weight of 132.12 g/mol. Its IUPAC name is 3,5-dihydroxy-2-oxopentanal.
| Compound Name | 3,5-dihydroxy-2-oxopentanal |
|---|---|
| PubChem CID | 135331774 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 3,5-dihydroxy-2-oxopentanal |
| SMILES | O=CC(=O)C(O)CCO |
| InChI | InChI=1S/C5H8O4/c6-2-1-4(8)5(9)3-7/h3-4,6,8H,1-2H2 |
| InChIKey | ACXWVDOVKJIXGS-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|