C12H22O6 — CID 175451441
5-(1,3-dihydroxypropyl)-7,9-dihydroxy-6-oxononanal (PubChem CID 175451441) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is 5-(1,3-dihydroxypropyl)-7,9-dihydroxy-6-oxononanal.
| Compound Name | 5-(1,3-dihydroxypropyl)-7,9-dihydroxy-6-oxononanal |
|---|---|
| PubChem CID | 175451441 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-(1,3-dihydroxypropyl)-7,9-dihydroxy-6-oxononanal |
| SMILES | O=CCCCC(C(=O)C(O)CCO)C(O)CCO |
| InChI | InChI=1S/C12H22O6/c13-6-2-1-3-9(10(16)4-7-14)12(18)11(17)5-8-15/h6,9-11,14-17H,1-5,7-8H2 |
| InChIKey | WFGHEQOMZWLRJC-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|