C4H12N2O4 — CID 174547822
propane-1,1,3-triol;urea (PubChem CID 174547822) has the molecular formula C4H12N2O4 and a molecular weight of 152.15 g/mol. Its IUPAC name is propane-1,1,3-triol;urea.
| Compound Name | propane-1,1,3-triol;urea |
|---|---|
| PubChem CID | 174547822 |
| Molecular Formula | C4H12N2O4 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | propane-1,1,3-triol;urea |
| SMILES | NC(N)=O.OCCC(O)O |
| InChI | InChI=1S/C3H8O3.CH4N2O/c4-2-1-3(5)6;2-1(3)4/h3-6H,1-2H2;(H4,2,3,4) |
| InChIKey | JZURZQKXGXYGDU-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|