About trihydroxy(hydroxymethyl)phosphanium;urea;chloride
trihydroxy(hydroxymethyl)phosphanium;urea;chloride (PubChem CID 118387771) has the molecular formula C2H10ClN2O5P
and a molecular weight of 208.54 g/mol. Its IUPAC name is trihydroxy(hydroxymethyl)phosphanium;urea;chloride.
Molecular Properties
| Compound Name | trihydroxy(hydroxymethyl)phosphanium;urea;chloride |
| PubChem CID | 118387771 |
| Molecular Formula | C2H10ClN2O5P |
| Molecular Weight | 208.54 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | trihydroxy(hydroxymethyl)phosphanium;urea;chloride |
| SMILES | NC(N)=O.OC[P+](O)(O)O.[Cl-] |
| InChI | InChI=1S/CH4N2O.CH6O4P.ClH/c2-1(3)4;2-1-6(3,4)5;/h(H4,2,3,4);2-5H,1H2;1H/q;+1;/p-1 |
| InChIKey | RPJBNFDSJNBDOW-UHFFFAOYSA-M |
| XLogP | -5.30 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 208.54 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trihydroxy(hydroxymethyl)phosphanium;urea;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihydroxy(hydroxymethyl)phosphanium;urea;chloride?
The IUPAC name of trihydroxy(hydroxymethyl)phosphanium;urea;chloride (CID 118387771) is trihydroxy(hydroxymethyl)phosphanium;urea;chloride.
What is the SMILES notation for trihydroxy(hydroxymethyl)phosphanium;urea;chloride?
The canonical SMILES for trihydroxy(hydroxymethyl)phosphanium;urea;chloride is NC(N)=O.OC[P+](O)(O)O.[Cl-].
What is the InChIKey of trihydroxy(hydroxymethyl)phosphanium;urea;chloride?
The InChIKey is RPJBNFDSJNBDOW-UHFFFAOYSA-M. The full InChI is InChI=1S/CH4N2O.CH6O4P.ClH/c2-1(3)4;2-1-6(3,4)5;/h(H4,2,3,4);2-5H,1H2;1H/q;+1;/p-1.
What are the key properties of trihydroxy(hydroxymethyl)phosphanium;urea;chloride?
trihydroxy(hydroxymethyl)phosphanium;urea;chloride has a molecular weight of 208.54 g/mol, XLogP of -5.30, 1 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trihydroxy(hydroxymethyl)phosphanium;urea;chloride is sourced from PubChem (CID 118387771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).