C7H16N2O5 — CID 158092381
propane-1,2,3-triol;prop-2-enal;urea (PubChem CID 158092381) has the molecular formula C7H16N2O5 and a molecular weight of 208.21 g/mol. Its IUPAC name is propane-1,2,3-triol;prop-2-enal;urea.
| Compound Name | propane-1,2,3-triol;prop-2-enal;urea |
|---|---|
| PubChem CID | 158092381 |
| Molecular Formula | C7H16N2O5 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | propane-1,2,3-triol;prop-2-enal;urea |
| SMILES | C=CC=O.NC(N)=O.OCC(O)CO |
| InChI | InChI=1S/C3H8O3.C3H4O.CH4N2O/c4-1-3(6)2-5;1-2-3-4;2-1(3)4/h3-6H,1-2H2;2-3H,1H2;(H4,2,3,4) |
| InChIKey | FOGNJSDPFWHCIK-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|