C12H20O2 — CID 88845718
11-hydroxy-4-methylundeca-1,6-dien-5-one (PubChem CID 88845718) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 11-hydroxy-4-methylundeca-1,6-dien-5-one.
| Compound Name | 11-hydroxy-4-methylundeca-1,6-dien-5-one |
|---|---|
| PubChem CID | 88845718 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 11-hydroxy-4-methylundeca-1,6-dien-5-one |
| SMILES | C=CCC(C)C(=O)C=CCCCCO |
| InChI | InChI=1S/C12H20O2/c1-3-8-11(2)12(14)9-6-4-5-7-10-13/h3,6,9,11,13H,1,4-5,7-8,10H2,2H3 |
| InChIKey | NNJAVYQLKNLJSD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|