C9H12F4O — CID 161308109
(E)-6,7,7,7-tetrafluoro-2,6-dimethylhept-4-en-3-one (PubChem CID 161308109) has the molecular formula C9H12F4O and a molecular weight of 212.19 g/mol. Its IUPAC name is (E)-6,7,7,7-tetrafluoro-2,6-dimethylhept-4-en-3-one.
| Compound Name | (E)-6,7,7,7-tetrafluoro-2,6-dimethylhept-4-en-3-one |
|---|---|
| PubChem CID | 161308109 |
| Molecular Formula | C9H12F4O |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (E)-6,7,7,7-tetrafluoro-2,6-dimethylhept-4-en-3-one |
| SMILES | CC(C)C(=O)/C=C/C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F4O/c1-6(2)7(14)4-5-8(3,10)9(11,12)13/h4-6H,1-3H3/b5-4+ |
| InChIKey | KRUMKFKZAZASHZ-SNAWJCMRSA-N |
| XLogP | 3.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|