C20H32O4 — CID 156963308
(3E,7E,12E)-11-hydroxy-3,7,11,15-tetramethyl-14-oxohexadeca-3,7,12-trienoic acid (PubChem CID 156963308) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (3E,7E,12E)-11-hydroxy-3,7,11,15-tetramethyl-14-oxohexadeca-3,7,12-trienoic acid.
| Compound Name | (3E,7E,12E)-11-hydroxy-3,7,11,15-tetramethyl-14-oxohexadeca-3,7,12-trienoic acid |
|---|---|
| PubChem CID | 156963308 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (3E,7E,12E)-11-hydroxy-3,7,11,15-tetramethyl-14-oxohexadeca-3,7,12-trienoic acid |
| SMILES | C/C(=C\CCC(C)(O)/C=C/C(=O)C(C)C)CC/C=C(\C)CC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-15(2)18(21)11-13-20(5,24)12-7-10-16(3)8-6-9-17(4)14-19(22)23/h9-11,13,15,24H,6-8,12,14H2,1-5H3,(H,22,23)/b13-11+,16-10+,17-9+ |
| InChIKey | HHAZEYQYXPTXMT-FQRNRSACSA-N |
| XLogP | 4.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|