C19H24O2 — CID 144669972
(E)-4,4-dimethyl-1-[4-[(E)-4-methyl-3-oxopent-1-enyl]phenyl]pent-1-en-3-one (PubChem CID 144669972) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (E)-4,4-dimethyl-1-[4-[(E)-4-methyl-3-oxopent-1-enyl]phenyl]pent-1-en-3-one.
| Compound Name | (E)-4,4-dimethyl-1-[4-[(E)-4-methyl-3-oxopent-1-enyl]phenyl]pent-1-en-3-one |
|---|---|
| PubChem CID | 144669972 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (E)-4,4-dimethyl-1-[4-[(E)-4-methyl-3-oxopent-1-enyl]phenyl]pent-1-en-3-one |
| SMILES | CC(C)C(=O)/C=C/c1ccc(/C=C/C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24O2/c1-14(2)17(20)12-10-15-6-8-16(9-7-15)11-13-18(21)19(3,4)5/h6-14H,1-5H3/b12-10+,13-11+ |
| InChIKey | KTEMZZYJUZDAGC-DCIPZJNNSA-N |
| XLogP | 4.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|