C12H16ClNO — CID 6446395
(E)-4,4-dimethyl-1-pyridin-4-ylpent-1-en-3-one;hydrochloride (PubChem CID 6446395) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is (E)-4,4-dimethyl-1-pyridin-4-ylpent-1-en-3-one;hydrochloride.
| Compound Name | (E)-4,4-dimethyl-1-pyridin-4-ylpent-1-en-3-one;hydrochloride |
|---|---|
| PubChem CID | 6446395 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (E)-4,4-dimethyl-1-pyridin-4-ylpent-1-en-3-one;hydrochloride |
| SMILES | CC(C)(C)C(=O)/C=C/c1ccncc1.Cl |
| InChI | InChI=1S/C12H15NO.ClH/c1-12(2,3)11(14)5-4-10-6-8-13-9-7-10;/h4-9H,1-3H3;1H/b5-4+; |
| InChIKey | LIRPFNMYBZGASU-FXRZFVDSSA-N |
| XLogP | 3.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|