C18H22O2 — CID 170603413
(E)-4,4-dimethyl-1-[4-[(E)-3-oxopent-1-enyl]phenyl]pent-1-en-3-one (PubChem CID 170603413) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (E)-4,4-dimethyl-1-[4-[(E)-3-oxopent-1-enyl]phenyl]pent-1-en-3-one.
| Compound Name | (E)-4,4-dimethyl-1-[4-[(E)-3-oxopent-1-enyl]phenyl]pent-1-en-3-one |
|---|---|
| PubChem CID | 170603413 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (E)-4,4-dimethyl-1-[4-[(E)-3-oxopent-1-enyl]phenyl]pent-1-en-3-one |
| SMILES | CCC(=O)/C=C/c1ccc(/C=C/C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H22O2/c1-5-16(19)12-10-14-6-8-15(9-7-14)11-13-17(20)18(2,3)4/h6-13H,5H2,1-4H3/b12-10+,13-11+ |
| InChIKey | CPHISTFHFYRBQE-DCIPZJNNSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|