C27H36O3 — CID 11429723
(E)-1-[3,5-bis[(E)-4,4-dimethyl-3-oxopent-1-enyl]phenyl]-4,4-dimethylpent-1-en-3-one (PubChem CID 11429723) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is (E)-1-[3,5-bis[(E)-4,4-dimethyl-3-oxopent-1-enyl]phenyl]-4,4-dimethylpent-1-en-3-one.
| Compound Name | (E)-1-[3,5-bis[(E)-4,4-dimethyl-3-oxopent-1-enyl]phenyl]-4,4-dimethylpent-1-en-3-one |
|---|---|
| PubChem CID | 11429723 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (E)-1-[3,5-bis[(E)-4,4-dimethyl-3-oxopent-1-enyl]phenyl]-4,4-dimethylpent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)/C=C/c1cc(/C=C/C(=O)C(C)(C)C)cc(/C=C/C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C27H36O3/c1-25(2,3)22(28)13-10-19-16-20(11-14-23(29)26(4,5)6)18-21(17-19)12-15-24(30)27(7,8)9/h10-18H,1-9H3/b13-10+,14-11+,15-12+ |
| InChIKey | WYBXXTRXZQAHDX-DZURWXOBSA-N |
| XLogP | 6.57 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|