C13H19NO — CID 143445458
(2E,4Z)-7-(methoxymethyl)-2-methyl-6-methylidenenona-2,4-dienenitrile (PubChem CID 143445458) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (2E,4Z)-7-(methoxymethyl)-2-methyl-6-methylidenenona-2,4-dienenitrile.
| Compound Name | (2E,4Z)-7-(methoxymethyl)-2-methyl-6-methylidenenona-2,4-dienenitrile |
|---|---|
| PubChem CID | 143445458 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (2E,4Z)-7-(methoxymethyl)-2-methyl-6-methylidenenona-2,4-dienenitrile |
| SMILES | C=C(/C=C\C=C(/C)C#N)C(CC)COC |
| InChI | InChI=1S/C13H19NO/c1-5-13(10-15-4)12(3)8-6-7-11(2)9-14/h6-8,13H,3,5,10H2,1-2,4H3/b8-6-,11-7+ |
| InChIKey | CJMMUOLUQCXQEK-FAWHLJIPSA-N |
| XLogP | 3.24 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|