(3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid

C12H14O2 — CID 131839742

IUPAC(3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid
SMILESC=C/C=C\C=C/C=C\C=C/CC(=O)O
InChIInChI=1S/C12H14O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-10H,1,11H2,(H,13,14)/b4-3-,6-5-,8-7-,10-9-
InChIKeyJSPNCMDQJNUPED-WKSFOPBCSA-N
MW190.24 g/mol
LogP2.87
Rot. Bonds6

About (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid

(3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid (PubChem CID 131839742) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid.

Molecular Properties

Compound Name(3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid
PubChem CID131839742
Molecular FormulaC12H14O2
Molecular Weight190.24 g/mol
Exact Mass190.10
IUPAC Name(3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid
SMILESC=C/C=C\C=C/C=C\C=C/CC(=O)O
InChIInChI=1S/C12H14O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-10H,1,11H2,(H,13,14)/b4-3-,6-5-,8-7-,10-9-
InChIKeyJSPNCMDQJNUPED-WKSFOPBCSA-N
XLogP2.87
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.24
LogP ≤ 52.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid?
The IUPAC name of (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid (CID 131839742) is (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid.
What is the SMILES notation for (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid?
The canonical SMILES for (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid is C=C/C=C\C=C/C=C\C=C/CC(=O)O.
What is the InChIKey of (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid?
The InChIKey is JSPNCMDQJNUPED-WKSFOPBCSA-N. The full InChI is InChI=1S/C12H14O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-10H,1,11H2,(H,13,14)/b4-3-,6-5-,8-7-,10-9-.
What are the key properties of (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid?
(3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid has a molecular weight of 190.24 g/mol, XLogP of 2.87, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z,7Z,9Z)-dodeca-3,5,7,9,11-pentaenoic acid is sourced from PubChem (CID 131839742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).