dodeca-3,5,7-trienoic acid

C12H18O2 — CID 151654337

IUPACdodeca-3,5,7-trienoic acid
SMILESCCCCC=CC=CC=CCC(=O)O
InChIInChI=1S/C12H18O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h5-10H,2-4,11H2,1H3,(H,13,14)
InChIKeyQVDXSXSDAXADTJ-UHFFFAOYSA-N
MW194.27 g/mol
LogP3.32
Rot. Bonds7

About dodeca-3,5,7-trienoic acid

dodeca-3,5,7-trienoic acid (PubChem CID 151654337) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is dodeca-3,5,7-trienoic acid.

Molecular Properties

Compound Namedodeca-3,5,7-trienoic acid
PubChem CID151654337
Molecular FormulaC12H18O2
Molecular Weight194.27 g/mol
Exact Mass194.13
IUPAC Namedodeca-3,5,7-trienoic acid
SMILESCCCCC=CC=CC=CCC(=O)O
InChIInChI=1S/C12H18O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h5-10H,2-4,11H2,1H3,(H,13,14)
InChIKeyQVDXSXSDAXADTJ-UHFFFAOYSA-N
XLogP3.32
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds7
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.27
LogP ≤ 53.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze dodeca-3,5,7-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dodeca-3,5,7-trienoic acid?
The IUPAC name of dodeca-3,5,7-trienoic acid (CID 151654337) is dodeca-3,5,7-trienoic acid.
What is the SMILES notation for dodeca-3,5,7-trienoic acid?
The canonical SMILES for dodeca-3,5,7-trienoic acid is CCCCC=CC=CC=CCC(=O)O.
What is the InChIKey of dodeca-3,5,7-trienoic acid?
The InChIKey is QVDXSXSDAXADTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h5-10H,2-4,11H2,1H3,(H,13,14).
What are the key properties of dodeca-3,5,7-trienoic acid?
dodeca-3,5,7-trienoic acid has a molecular weight of 194.27 g/mol, XLogP of 3.32, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodeca-3,5,7-trienoic acid is sourced from PubChem (CID 151654337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).