C15H26O2 — CID 91404982
pentadeca-3,5-dienoic acid (PubChem CID 91404982) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is pentadeca-3,5-dienoic acid.
| Compound Name | pentadeca-3,5-dienoic acid |
|---|---|
| PubChem CID | 91404982 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | pentadeca-3,5-dienoic acid |
| SMILES | CCCCCCCCCC=CC=CCC(=O)O |
| InChI | InChI=1S/C15H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h10-13H,2-9,14H2,1H3,(H,16,17) |
| InChIKey | RBBGZKXPCWIIEF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|