C20H32O4 — CID 10449686
(5Z,8Z,10Z,12E)-5,6-dihydroxyicosa-5,8,10,12-tetraenoic acid (PubChem CID 10449686) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (5Z,8Z,10Z,12E)-5,6-dihydroxyicosa-5,8,10,12-tetraenoic acid.
| Compound Name | (5Z,8Z,10Z,12E)-5,6-dihydroxyicosa-5,8,10,12-tetraenoic acid |
|---|---|
| PubChem CID | 10449686 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (5Z,8Z,10Z,12E)-5,6-dihydroxyicosa-5,8,10,12-tetraenoic acid |
| SMILES | CCCCCCC/C=C/C=C\C=C/C/C(O)=C(/O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(21)19(22)16-14-17-20(23)24/h8-13,21-22H,2-7,14-17H2,1H3,(H,23,24)/b9-8+,11-10-,13-12-,19-18- |
| InChIKey | IPXHVPITGNIEFI-NEVVZNDISA-N |
| XLogP | 5.99 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|