C14H20O2 — CID 162716798
7-oxotetradeca-9,11,13-trienal (PubChem CID 162716798) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 7-oxotetradeca-9,11,13-trienal.
| Compound Name | 7-oxotetradeca-9,11,13-trienal |
|---|---|
| PubChem CID | 162716798 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 7-oxotetradeca-9,11,13-trienal |
| SMILES | C=CC=CC=CCC(=O)CCCCCC=O |
| InChI | InChI=1S/C14H20O2/c1-2-3-4-5-8-11-14(16)12-9-6-7-10-13-15/h2-5,8,13H,1,6-7,9-12H2 |
| InChIKey | SUBWDKBELXQQHY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|