C12H27NO2 — CID 163672470
(1S,4R,5S)-1-amino-5,9-dimethyldecane-1,4-diol (PubChem CID 163672470) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is (1S,4R,5S)-1-amino-5,9-dimethyldecane-1,4-diol.
| Compound Name | (1S,4R,5S)-1-amino-5,9-dimethyldecane-1,4-diol |
|---|---|
| PubChem CID | 163672470 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | (1S,4R,5S)-1-amino-5,9-dimethyldecane-1,4-diol |
| SMILES | CC(C)CCC[C@H](C)[C@H](O)CC[C@@H](N)O |
| InChI | InChI=1S/C12H27NO2/c1-9(2)5-4-6-10(3)11(14)7-8-12(13)15/h9-12,14-15H,4-8,13H2,1-3H3/t10-,11+,12-/m0/s1 |
| InChIKey | JDTUFGMDJHLENP-TUAOUCFPSA-N |
| XLogP | 1.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|