C19H35N — CID 135278146
(3E,5Z)-6-methyl-N-[(3S)-7-methyloctan-3-yl]nona-1,3,5-trien-3-amine (PubChem CID 135278146) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is (3E,5Z)-6-methyl-N-[(3S)-7-methyloctan-3-yl]nona-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-6-methyl-N-[(3S)-7-methyloctan-3-yl]nona-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 135278146 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | (3E,5Z)-6-methyl-N-[(3S)-7-methyloctan-3-yl]nona-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C=C(\C)CCC)N[C@@H](CC)CCCC(C)C |
| InChI | InChI=1S/C19H35N/c1-7-11-17(6)14-15-19(9-3)20-18(8-2)13-10-12-16(4)5/h9,14-16,18,20H,3,7-8,10-13H2,1-2,4-6H3/b17-14-,19-15+/t18-/m0/s1 |
| InChIKey | RJBHJACQQJDAIQ-OLWHEQAKSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|