C14H27N — CID 170600051
ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylpentan-1-amine (PubChem CID 170600051) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylpentan-1-amine.
| Compound Name | ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 170600051 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylpentan-1-amine |
| SMILES | C=C/C=C(\C=C)NCCCC(C)C.CC |
| InChI | InChI=1S/C12H21N.C2H6/c1-5-8-12(6-2)13-10-7-9-11(3)4;1-2/h5-6,8,11,13H,1-2,7,9-10H2,3-4H3;1-2H3/b12-8+; |
| InChIKey | GUMSZVYWSORSLT-MXZHIVQLSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|